Product Name: | Bis(2-chloro-4-nitrophenyl) ether |
CAS NO.: | 13867-27-1 |
Molecular Formula: | C12H6Cl2N2O5 |
Molecular Weight: | |
Einecs: | |
Melting Point: | |
Boiling Point: | |
Flash Point: | |
Solubilit: |
Assay:99.0% Appearance:liquid Package:Grams, Kilograms Storage:Store the container tightly closed in a dry, cool and well-ventilated place. Store apart from foodstuff containers or incompatible materials. Transportation:According to customer request Application:For R&D and commerical use
Min. Order:100Gram
Supplier:Chemlyte Solutions [ China (Mainland)]